This is an old revision of the document!
Table of Contents
API base url: https://mcule.com/api/v1/
Examples are demonstrated with HTTPie.
Response status codes
- 200 OK - Success response
- 400 BAD REQUEST - A validation error typically
- 401 UNAUTHORIZED - Unauthorized
- 403 FORBIDDEN - Permission denied
- 404 NOT FOUND - Not found
- 500 SERVER ERROR - Something went wrong
Public API endpoints
Public API endpoints are accessible to everyone, without authentication.
Database files
Endpoint:
/database-files/
Example API request:
http https://mcule.com/api/v1/database-files/ --print HBhb
Request:
GET /api/v1/database-files/ HTTP/1.1 Accept: */* Accept-Encoding: gzip, deflate
Response:
HTTP/1.1 200 OK Allow: GET, HEAD, OPTIONS Content-Type: application/json [ { "created": "2015-05-18", "description": "Gzipped 2D SDF of all purchasable compounds", "download_size_gb": 2.2, "download_url": "https://mcule.s3.amazonaws.com/mcule_purchasable_compounds_150518.sdf.gz", "entry_count": 11695894, "name": "mcule_purchasable_compounds" }, { "created": "2015-05-18", "description": "Gzipped 2D SDF of in stock compounds with known or unknown exact stock amount", "download_size_gb": 1.4, "download_url": "https://mcule.s3.amazonaws.com/mcule_in_stock_compounds_150518.sdf.gz", "entry_count": 5827052, "name": "mcule_in_stock_compounds" }, { "created": "2015-05-18", "description": "Gzipped 2D SDF of in stock compounds with known exact stock amount", "download_size_gb": 1.2, "download_url": "https://mcule.s3.amazonaws.com/mcule_known_stock_amount_compounds_150518.sdf.gz", "entry_count": 4922295, "name": "mcule_known_stock_amount_compounds" }, { "created": "2015-08-20", "description": "Gzipped 2D SDF of purchasable compounds with known prices", "download_size_gb": 2.2, "download_url": "https://mcule.s3.amazonaws.com/mcule_instant_quotable_compounds_150820.sdf.gz", "entry_count": 11533450, "name": "mcule_instant_quotable_compounds" }, { "created": "2014-07-21", "description": "Gzipped csv (delimiter: tab) of all compounds with mcule ID, standard InChI and InChIKey", "download_size_gb": 0.4, "download_url": "https://mcule.s3.amazonaws.com/mcule_inchies_140721.csv.gz", "entry_count": 7334938, "name": "mcule_inchies" } ]
Compound details
Endpoint:
/compound/<mcule_id>/
Example API request:
http https://mcule.com/api/v1/compound/MCULE-9380369173/ --print HBhb
Request:
GET /api/v1/compound/MCULE-9380369173/ HTTP/1.1 Accept: */* Accept-Encoding: gzip, deflate
Response:
HTTP/1.1 200 OK Allow: GET, HEAD, OPTIONS Content-Encoding: gzip Content-Type: application/json { "components": [], "formula": "C15H11N3O2S2", "inchi_key": "WVRLGAPZMSKMGL-UHFFFAOYSA-N", "mcule_id": "MCULE-9380369173", "mol": "\n mcule 05121714262D\n\n 22 24 0 0 0 0 0 0 0 0999 V2000\n 3.8489 4.0497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8489 3.0496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9831 2.5496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1169 3.0496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9831 1.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7922 0.9621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4832 0.0109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4829 0.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8951 -0.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9006 -0.6935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3127 -1.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6220 -2.4537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1871 -3.0416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9960 -2.4537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6872 -1.5025 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9472 -2.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1550 -3.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1061 -4.0497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8489 -3.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6412 -2.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6901 -2.0935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1740 0.9621 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 3 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 11 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 16 21 2 0 0 0 0\n 8 22 1 0 0 0 0\n 5 22 1 0 0 0 0\nM END", "properties": { "atoms": 33, "components": 1, "ct_bonds": 1, "h_bond_acceptors": 5, "h_bond_donors": 0, "halogen_atoms": 0, "heavy_atoms": 22, "heteroatoms": 7, "hydrogens": 11, "known_ct_bonds": 0, "known_stereocenters": 0, "logp": 3.6186, "mol_mass": 329.401, "non_organic_atoms": 0, "o_and_n_atoms": 5, "psa": 121.45, "r3_violations": 5, "r5_violations": 0, "refractivity": 87.6665, "rings": 3, "rotatable_bonds": 5, "stereocenters": 0, "undef_ct_bonds": 0, "undef_stereocenters": 0, "unknown_ct_bonds": 1, "unknown_stereocenters": 0 }, "smiles": "COC(C1SC(C=CC2SC(C3=NC=CC=C3)=NC=2)=NC=1)=O", "std_inchi": "InChI=1S/C15H11N3O2S2/c1-20-15(19)12-9-17-13(22-12)6-5-10-8-18-14(21-10)11-4-2-3-7-16-11/h2-9H,1H3", "stereo_type": "none", "url": "http://mcule.com/MCULE-9380369173/" }
InChIKey lookup
Endpoint:
/lookup/<inchi_key>
Example API request:
http https://mcule.com/api/v1/lookup/inchikey/WVRLGAPZMSKMGL-UHFFFAOYSA-N --print HBhb
Request:
GET /api/v1/lookup/inchikey/WVRLGAPZMSKMGL-UHFFFAOYSA-N HTTP/1.1 Accept: */* Accept-Encoding: gzip, deflate
Response:
HTTP/1.1 200 OK Allow: GET, HEAD, OPTIONS Content-Encoding: gzip Content-Type: application/json { "results": [ { "mcule_id": "MCULE-9380369173", "smiles": "COC(C1SC(C=CC2SC(C3=NC=CC=C3)=NC=2)=NC=1)=O", "url": "http://mcule.com/MCULE-9380369173/" } ] }
Single query search / lookup
Endpoint:
/search/lookup/?query=<your_query>
Where the query can be an mcule ID, SMILES, InChI or InChIKey identifier.
Example API request:
http 'https://mcule.com/api/v1/search/lookup/?query=COC(C1SC(C=CC2SC(C3=NC=CC=C3)=NC=2)=NC=1)=O' --print HBhb
Request:
GET /api/v1/search/lookup/?query=COC(C1SC(C=CC2SC(C3=NC=CC=C3)=NC=2)=NC=1)=O HTTP/1.1 Accept: */* Accept-Encoding: gzip, deflate
Response:
HTTP/1.1 200 OK Allow: GET, HEAD, OPTIONS Content-Encoding: gzip Content-Type: application/json { "results": [ { "mcule_id": "MCULE-9380369173", "smiles": "COC(C1SC(C=CC2SC(C3=NC=CC=C3)=NC=2)=NC=1)=O", "url": "http://mcule.com/MCULE-9380369173/" } ] }
Authentication
Authentication is currently a token based authentication. If you would like to access our protected API endpoints, please drop us an email at info@mcule.com and we can provide you with a token.
Once you have a valid token you have to send it in the Authorization header:
Authorization: Token <your_token>
Protected API endpoints
Protected API endpoints are only accessible if a valid token is provided in the Authorization header of the request.
Compound availability
Endpoint:
/compound/<mcule_id>/availability/
Example API request:
http https://mcule.com/api/v1/compound/MCULE-9380369173/availability/ "Authorization: Token <your_token>" --print HBhb
Request:
GET /api/v1/compound/MCULE-9380369173/availability/ HTTP/1.1 Accept: */* Accept-Encoding: gzip, deflate Authorization: Token <your_token>
Response:
HTTP/1.1 200 OK Allow: GET, HEAD, OPTIONS Content-Encoding: gzip Content-Type: application/json { "availability_type": "in stock", "confirmed_amount": 242, "confirmed_amount_unit": "mg" }
Compound prices
Endpoint:
/compound/<mcule_id>/prices/
Example API request:
http https://mcule.com/api/v1/compound/MCULE-9380369173/prices/ "Authorization: Token <your_token>" --print HBhb
Request:
GET /api/v1/compound/MCULE-9380369173/prices/ HTTP/1.1 Accept: */* Accept-Encoding: gzip, deflate Authorization: Token <your_token>
Response:
HTTP/1.1 200 OK Allow: GET, HEAD, OPTIONS Content-Encoding: gzip Content-Type: application/json { "best_prices": [ { "amount": 1, "currency": "USD", "delivery_time_working_days": 9, "price": 107, "purity": 90, "unit": "mg" }, { "amount": 5, "currency": "USD", "delivery_time_working_days": 9, "price": 116, "purity": 90, "unit": "mg" }, { "amount": 10, "currency": "USD", "delivery_time_working_days": 9, "price": 151, "purity": 90, "unit": "mg" } ] }
It returns the best prices for 1mg, 5mg and 10mg amounts by default. You can specify amounts of your choice in the amounts GET parameter:
http 'https://mcule.com/api/v1/compound/MCULE-9380369173/prices/?amounts=15,20' "Authorization: Token <your_token>" --print HBhb
Multiple queries exact search
Multiple queries exact search currently accepts the following input identifiers: mcule ID, SMILES, InChI or InChIKey identifiers.
Endpoint:
/search/exact/
Example API request:
echo '{"queries": ["COC(C1SC(C=CC2SC(C3=NC=CC=C3)=NC=2)=NC=1)=O", "CC1=C(C(N2CC3C(CCC3N)C2)=O)SC(CC2=CC=CC=C2)=N1", "C1([C@H](C(C)C)NC(CCCCC2CCSS2)=O)NC2=C(C=CC=C2)N=1", "C1C=C(COC(C(O)(CC2C=CC(O)=CC=2)C(C)OC(C(O)(CC2C=CC(O)=CC=2)C(C)OC(C)=O)=O)=O)C=CC=1OC1C(O)C(O)C(O)C(CO)O1", "CCCCC1=CC=C(CC(N(CC2CCN(C)CC2)C)=O)C=C1"]}' | http https://mcule.com/api/v1/search/exact/ "Authorization: Token <your_token>" --print HBhb
Request:
POST /api/v1/search/exact/ HTTP/1.1 Accept: application/json Accept-Encoding: gzip, deflate Authorization: Token <your_token> Content-Type: application/json { "queries": [ "COC(C1SC(C=CC2SC(C3=NC=CC=C3)=NC=2)=NC=1)=O", "CC1=C(C(N2CC3C(CCC3N)C2)=O)SC(CC2=CC=CC=C2)=N1", "C1([C@H](C(C)C)NC(CCCCC2CCSS2)=O)NC2=C(C=CC=C2)N=1", "C1C=C(COC(C(O)(CC2C=CC(O)=CC=2)C(C)OC(C(O)(CC2C=CC(O)=CC=2)C(C)OC(C)=O)=O)=O)C=CC=1OC1C(O)C(O)C(O)C(CO)O1", "CCCCC1=CC=C(CC(N(CC2CCN(C)CC2)C)=O)C=C1" ] }
Response:
HTTP/1.1 200 OK Allow: POST, OPTIONS Content-Encoding: gzip Content-Type: application/json { "results": [ { "input_index": 1, "mcule_id": "MCULE-9380369173", "smiles": "COC(C1SC(C=CC2SC(C3=NC=CC=C3)=NC=2)=NC=1)=O", "url": "http://mcule.com/MCULE-9380369173/" }, { "input_index": 2, "mcule_id": "MCULE-4016901520", "smiles": "CC1=C(C(N2CC3C(CCC3N)C2)=O)SC(CC2=CC=CC=C2)=N1", "url": "http://mcule.com/MCULE-4016901520/" }, { "input_index": 3, "mcule_id": "MCULE-7428195288", "smiles": "C1([C@H](C(C)C)NC(CCCC[C@H]2CCSS2)=O)NC2=C(C=CC=C2)N=1", "url": "http://mcule.com/MCULE-7428195288/" }, { "input_index": 5, "mcule_id": "MCULE-1259420189", "smiles": "CCCCC1=CC=C(CC(N(CC2CCN(C)CC2)C)=O)C=C1", "url": "http://mcule.com/MCULE-1259420189/" } ] }
Multiple queries exact search with availability
Endpoint:
/search/exact/availability/
Example API request:
echo {"queries": ["COC(C1SC(C=CC2SC(C3=NC=CC=C3)=NC=2)=NC=1)=O", "CC1=C(C(N2CC3C(CCC3N)C2)=O)SC(CC2=CC=CC=C2)=N1", "C1([C@H](C(C)C)NC(CCCCC2CCSS2)=O)NC2=C(C=CC=C2)N=1", "C1C=C(COC(C(O)(CC2C=CC(O)=CC=2)C(C)OC(C(O)(CC2C=CC(O)=CC=2)C(C)OC(C)=O)=O)=O)C=CC=1OC1C(O)C(O)C(O)C(CO)O1", "CCCCC1=CC=C(CC(N(CC2CCN(C)CC2)C)=O)C=C1"]} | http https://mcule.com/api/v1/search/exact/availability/ "Authorization: Token <your_token>" --print HBhb
Request:
POST /api/v1/search/exact/availability/ HTTP/1.1 Accept: application/json Accept-Encoding: gzip, deflate Authorization: Token <your_token> Content-Type: application/json { "queries": [ "COC(C1SC(C=CC2SC(C3=NC=CC=C3)=NC=2)=NC=1)=O", "CC1=C(C(N2CC3C(CCC3N)C2)=O)SC(CC2=CC=CC=C2)=N1", "C1([C@H](C(C)C)NC(CCCCC2CCSS2)=O)NC2=C(C=CC=C2)N=1", "C1C=C(COC(C(O)(CC2C=CC(O)=CC=2)C(C)OC(C(O)(CC2C=CC(O)=CC=2)C(C)OC(C)=O)=O)=O)C=CC=1OC1C(O)C(O)C(O)C(CO)O1", "CCCCC1=CC=C(CC(N(CC2CCN(C)CC2)C)=O)C=C1" ] }
Response:
HTTP/1.1 200 OK Allow: POST, OPTIONS Content-Encoding: gzip Content-Type: application/json { "results": [ { "availability": { "availability_type": "in stock", "confirmed_amount": 242, "confirmed_amount_unit": "mg" }, "input_index": 1, "mcule_id": "MCULE-9380369173", "smiles": "COC(C1SC(C=CC2SC(C3=NC=CC=C3)=NC=2)=NC=1)=O", "url": "http://mcule.com/MCULE-9380369173/" }, { "availability": { "availability_type": "in stock", "confirmed_amount": null, "confirmed_amount_unit": "mg" }, "input_index": 2, "mcule_id": "MCULE-4016901520", "smiles": "CC1=C(C(N2CC3C(CCC3N)C2)=O)SC(CC2=CC=CC=C2)=N1", "url": "http://mcule.com/MCULE-4016901520/" }, { "availability": { "availability_type": "in stock", "confirmed_amount": null, "confirmed_amount_unit": "mg" }, "input_index": 3, "mcule_id": "MCULE-7428195288", "smiles": "C1([C@H](C(C)C)NC(CCCC[C@H]2CCSS2)=O)NC2=C(C=CC=C2)N=1", "url": "http://mcule.com/MCULE-7428195288/" }, { "availability": { "availability_type": "potentially purchasable", "confirmed_amount": null, "confirmed_amount_unit": "mg" }, "input_index": 5, "mcule_id": "MCULE-1259420189", "smiles": "CCCCC1=CC=C(CC(N(CC2CCN(C)CC2)C)=O)C=C1", "url": "http://mcule.com/MCULE-1259420189/" } ] }